C26H41NO7Si — CID 10918211
tert-butyl (E,4R,5R)-4-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)hex-2-enoate (PubChem CID 10918211) has the molecular formula C26H41NO7Si and a molecular weight of 507.70 g/mol. Its IUPAC name is tert-butyl (E,4R,5R)-4-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)hex-2-enoate.
| Compound Name | tert-butyl (E,4R,5R)-4-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)hex-2-enoate |
|---|---|
| PubChem CID | 10918211 |
| Molecular Formula | C26H41NO7Si |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl (E,4R,5R)-4-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)hex-2-enoate |
| SMILES | CC(=O)O[C@H](/C=C/C(=O)OC(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H41NO7Si/c1-19(28)33-22(15-16-23(29)34-25(2,3)4)21(18-32-35(8,9)26(5,6)7)27-24(30)31-17-20-13-11-10-12-14-20/h10-16,21-22H,17-18H2,1-9H3,(H,27,30)/b16-15+/t21-,22-/m1/s1 |
| InChIKey | GLCCAPZUNAICSQ-XSWAMMJBSA-N |
| XLogP | 5.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|