C28H39NO9Si — CID 11238344
[(2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-methoxy-6-oxo-2-(phenylmethoxycarbonylamino)hexan-3-yl] benzoate (PubChem CID 11238344) has the molecular formula C28H39NO9Si and a molecular weight of 561.70 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-methoxy-6-oxo-2-(phenylmethoxycarbonylamino)hexan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-methoxy-6-oxo-2-(phenylmethoxycarbonylamino)hexan-3-yl] benzoate |
|---|---|
| PubChem CID | 11238344 |
| Molecular Formula | C28H39NO9Si |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | [(2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-methoxy-6-oxo-2-(phenylmethoxycarbonylamino)hexan-3-yl] benzoate |
| SMILES | COC(=O)[C@H](O)[C@@H](O)[C@@H](OC(=O)c1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H39NO9Si/c1-28(2,3)39(5,6)37-18-21(29-27(34)36-17-19-13-9-7-10-14-19)24(22(30)23(31)26(33)35-4)38-25(32)20-15-11-8-12-16-20/h7-16,21-24,30-31H,17-18H2,1-6H3,(H,29,34)/t21-,22-,23-,24+/m1/s1 |
| InChIKey | NWIPJECRHZNUIP-YCAMKHIRSA-N |
| XLogP | 3.42 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|