C22H30ClNO3Si — CID 150347845
benzyl N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)ethyl]carbamate (PubChem CID 150347845) has the molecular formula C22H30ClNO3Si and a molecular weight of 420.03 g/mol. Its IUPAC name is benzyl N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)ethyl]carbamate.
| Compound Name | benzyl N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 150347845 |
| Molecular Formula | C22H30ClNO3Si |
| Molecular Weight | 420.03 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | benzyl N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](NC(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30ClNO3Si/c1-22(2,3)28(4,5)27-16-20(18-11-13-19(23)14-12-18)24-21(25)26-15-17-9-7-6-8-10-17/h6-14,20H,15-16H2,1-5H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | GTCDNLKWVZXKQL-HXUWFJFHSA-N |
| XLogP | 6.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.03 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|