C21H22ClNO6 — CID 66755418
benzyl 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate (PubChem CID 66755418) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is benzyl 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate.
| Compound Name | benzyl 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate |
|---|---|
| PubChem CID | 66755418 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | benzyl 4-(acetyloxymethoxycarbonylamino)-4-(4-chlorophenyl)butanoate |
| SMILES | CC(=O)OCOC(=O)NC(CCC(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO6/c1-15(24)28-14-29-21(26)23-19(17-7-9-18(22)10-8-17)11-12-20(25)27-13-16-5-3-2-4-6-16/h2-10,19H,11-14H2,1H3,(H,23,26) |
| InChIKey | CEZGNOYMRXGEQY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|