C17H16ClNO6S — CID 66842372
4-(4-chlorophenyl)-4-(thiophene-2-carbonyloxymethoxycarbonylamino)butanoic acid (PubChem CID 66842372) has the molecular formula C17H16ClNO6S and a molecular weight of 397.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-(thiophene-2-carbonyloxymethoxycarbonylamino)butanoic acid.
| Compound Name | 4-(4-chlorophenyl)-4-(thiophene-2-carbonyloxymethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 66842372 |
| Molecular Formula | C17H16ClNO6S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-(4-chlorophenyl)-4-(thiophene-2-carbonyloxymethoxycarbonylamino)butanoic acid |
| SMILES | O=C(O)CCC(NC(=O)OCOC(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO6S/c18-12-5-3-11(4-6-12)13(7-8-15(20)21)19-17(23)25-10-24-16(22)14-2-1-9-26-14/h1-6,9,13H,7-8,10H2,(H,19,23)(H,20,21) |
| InChIKey | ZXVSGPHBXLSUET-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|