C18H15NO3S2 — CID 3585331
[2-phenyl-2-(thiophene-2-carbonylamino)ethyl] thiophene-2-carboxylate (PubChem CID 3585331) has the molecular formula C18H15NO3S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [2-phenyl-2-(thiophene-2-carbonylamino)ethyl] thiophene-2-carboxylate.
| Compound Name | [2-phenyl-2-(thiophene-2-carbonylamino)ethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3585331 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [2-phenyl-2-(thiophene-2-carbonylamino)ethyl] thiophene-2-carboxylate |
| SMILES | O=C(NC(COC(=O)c1cccs1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H15NO3S2/c20-17(15-8-4-10-23-15)19-14(13-6-2-1-3-7-13)12-22-18(21)16-9-5-11-24-16/h1-11,14H,12H2,(H,19,20) |
| InChIKey | FMIVZCFJSVLKPC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |