C18H14BrNOS — CID 95151159
N-[(S)-(4-bromophenyl)-phenylmethyl]thiophene-2-carboxamide (PubChem CID 95151159) has the molecular formula C18H14BrNOS and a molecular weight of 372.29 g/mol. Its IUPAC name is N-[(S)-(4-bromophenyl)-phenylmethyl]thiophene-2-carboxamide.
| Compound Name | N-[(S)-(4-bromophenyl)-phenylmethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95151159 |
| Molecular Formula | C18H14BrNOS |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | N-[(S)-(4-bromophenyl)-phenylmethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C18H14BrNOS/c19-15-10-8-14(9-11-15)17(13-5-2-1-3-6-13)20-18(21)16-7-4-12-22-16/h1-12,17H,(H,20,21)/t17-/m0/s1 |
| InChIKey | YFSMYIFBWIWDKZ-KRWDZBQOSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |