C13H9BrCl3NO2S — CID 45125850
N-[1-(4-bromophenoxy)-2,2,2-trichloroethyl]thiophene-2-carboxamide (PubChem CID 45125850) has the molecular formula C13H9BrCl3NO2S and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[1-(4-bromophenoxy)-2,2,2-trichloroethyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-bromophenoxy)-2,2,2-trichloroethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45125850 |
| Molecular Formula | C13H9BrCl3NO2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 426.86 |
| IUPAC Name | N-[1-(4-bromophenoxy)-2,2,2-trichloroethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(Oc1ccc(Br)cc1)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C13H9BrCl3NO2S/c14-8-3-5-9(6-4-8)20-12(13(15,16)17)18-11(19)10-2-1-7-21-10/h1-7,12H,(H,18,19) |
| InChIKey | OOCWAJRQYKPXDU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|