C15H11Cl4NO2 — CID 4117708
2-chloro-N-(2,2,2-trichloro-1-phenoxyethyl)benzamide (PubChem CID 4117708) has the molecular formula C15H11Cl4NO2 and a molecular weight of 379.07 g/mol. Its IUPAC name is 2-chloro-N-(2,2,2-trichloro-1-phenoxyethyl)benzamide.
| Compound Name | 2-chloro-N-(2,2,2-trichloro-1-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 4117708 |
| Molecular Formula | C15H11Cl4NO2 |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 2-chloro-N-(2,2,2-trichloro-1-phenoxyethyl)benzamide |
| SMILES | O=C(NC(Oc1ccccc1)C(Cl)(Cl)Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl4NO2/c16-12-9-5-4-8-11(12)13(21)20-14(15(17,18)19)22-10-6-2-1-3-7-10/h1-9,14H,(H,20,21) |
| InChIKey | RRSNTDNFBSFRAC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|