C22H17Cl4NO2 — CID 3281338
2,2-diphenyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]acetamide (PubChem CID 3281338) has the molecular formula C22H17Cl4NO2 and a molecular weight of 469.20 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 3281338 |
| Molecular Formula | C22H17Cl4NO2 |
| Molecular Weight | 469.20 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-(4-chlorophenoxy)ethyl]acetamide |
| SMILES | O=C(NC(Oc1ccc(Cl)cc1)C(Cl)(Cl)Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl4NO2/c23-17-11-13-18(14-12-17)29-21(22(24,25)26)27-20(28)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19,21H,(H,27,28) |
| InChIKey | VUFBRXYYLQIVNN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|