C17H14Cl6N2O3 — CID 2834303
1,3-bis(2,2,2-trichloro-1-phenoxyethyl)urea (PubChem CID 2834303) has the molecular formula C17H14Cl6N2O3 and a molecular weight of 507.03 g/mol. Its IUPAC name is 1,3-bis(2,2,2-trichloro-1-phenoxyethyl)urea.
| Compound Name | 1,3-bis(2,2,2-trichloro-1-phenoxyethyl)urea |
|---|---|
| PubChem CID | 2834303 |
| Molecular Formula | C17H14Cl6N2O3 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 503.91 |
| IUPAC Name | 1,3-bis(2,2,2-trichloro-1-phenoxyethyl)urea |
| SMILES | O=C(NC(Oc1ccccc1)C(Cl)(Cl)Cl)NC(Oc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H14Cl6N2O3/c18-16(19,20)13(27-11-7-3-1-4-8-11)24-15(26)25-14(17(21,22)23)28-12-9-5-2-6-10-12/h1-10,13-14H,(H2,24,25,26) |
| InChIKey | SFPZUOMORIBRPZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|