C16H22Cl3NO2 — CID 3118267
N-(2,2,2-trichloro-1-phenoxyethyl)octanamide (PubChem CID 3118267) has the molecular formula C16H22Cl3NO2 and a molecular weight of 366.72 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-phenoxyethyl)octanamide.
| Compound Name | N-(2,2,2-trichloro-1-phenoxyethyl)octanamide |
|---|---|
| PubChem CID | 3118267 |
| Molecular Formula | C16H22Cl3NO2 |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(2,2,2-trichloro-1-phenoxyethyl)octanamide |
| SMILES | CCCCCCCC(=O)NC(Oc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3NO2/c1-2-3-4-5-9-12-14(21)20-15(16(17,18)19)22-13-10-7-6-8-11-13/h6-8,10-11,15H,2-5,9,12H2,1H3,(H,20,21) |
| InChIKey | FLGWIJWLYAFDSY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|