C12H22Cl3NO2 — CID 21176444
N-(2,2,2-trichloro-1-hydroxyethyl)decanamide (PubChem CID 21176444) has the molecular formula C12H22Cl3NO2 and a molecular weight of 318.67 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-hydroxyethyl)decanamide.
| Compound Name | N-(2,2,2-trichloro-1-hydroxyethyl)decanamide |
|---|---|
| PubChem CID | 21176444 |
| Molecular Formula | C12H22Cl3NO2 |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(2,2,2-trichloro-1-hydroxyethyl)decanamide |
| SMILES | CCCCCCCCCC(=O)NC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H22Cl3NO2/c1-2-3-4-5-6-7-8-9-10(17)16-11(18)12(13,14)15/h11,18H,2-9H2,1H3,(H,16,17) |
| InChIKey | UGDUQSHWSAQIIA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|