C14H26Cl3N2O+ — CID 7035753
N-[(1S)-2,2,2-trichloro-1-piperidin-1-ium-1-ylethyl]heptanamide (PubChem CID 7035753) has the molecular formula C14H26Cl3N2O+ and a molecular weight of 344.73 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-piperidin-1-ium-1-ylethyl]heptanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-piperidin-1-ium-1-ylethyl]heptanamide |
|---|---|
| PubChem CID | 7035753 |
| Molecular Formula | C14H26Cl3N2O+ |
| Molecular Weight | 344.73 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-piperidin-1-ium-1-ylethyl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@@H]([NH+]1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H25Cl3N2O/c1-2-3-4-6-9-12(20)18-13(14(15,16)17)19-10-7-5-8-11-19/h13H,2-11H2,1H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | MSORWMJLVDTLQH-ZDUSSCGKSA-O |
| XLogP | 2.84 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|