C10H18Cl3NO2 — CID 2833337
N-(2,2,2-trichloro-1-hydroxyethyl)octanamide (PubChem CID 2833337) has the molecular formula C10H18Cl3NO2 and a molecular weight of 290.62 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-hydroxyethyl)octanamide.
| Compound Name | N-(2,2,2-trichloro-1-hydroxyethyl)octanamide |
|---|---|
| PubChem CID | 2833337 |
| Molecular Formula | C10H18Cl3NO2 |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-(2,2,2-trichloro-1-hydroxyethyl)octanamide |
| SMILES | CCCCCCCC(=O)NC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H18Cl3NO2/c1-2-3-4-5-6-7-8(15)14-9(16)10(11,12)13/h9,16H,2-7H2,1H3,(H,14,15) |
| InChIKey | SNKYGGGBBJDZMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|