C12H13Cl4NO2 — CID 7025439
N-[(1S)-2,2,2-trichloro-1-(2-chlorophenoxy)ethyl]butanamide (PubChem CID 7025439) has the molecular formula C12H13Cl4NO2 and a molecular weight of 345.05 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(2-chlorophenoxy)ethyl]butanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(2-chlorophenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 7025439 |
| Molecular Formula | C12H13Cl4NO2 |
| Molecular Weight | 345.05 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(2-chlorophenoxy)ethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](Oc1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl4NO2/c1-2-5-10(18)17-11(12(14,15)16)19-9-7-4-3-6-8(9)13/h3-4,6-7,11H,2,5H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | ATOJWCANZMSLDN-NSHDSACASA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|