C16H18Cl6N2O6 — CID 5061853
ethyl N-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-(ethoxycarbonylamino)ethoxy]phenoxy]ethyl]carbamate (PubChem CID 5061853) has the molecular formula C16H18Cl6N2O6 and a molecular weight of 547.05 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-(ethoxycarbonylamino)ethoxy]phenoxy]ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-(ethoxycarbonylamino)ethoxy]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 5061853 |
| Molecular Formula | C16H18Cl6N2O6 |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-(ethoxycarbonylamino)ethoxy]phenoxy]ethyl]carbamate |
| SMILES | CCOC(=O)NC(Oc1ccccc1OC(NC(=O)OCC)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl6N2O6/c1-3-27-13(25)23-11(15(17,18)19)29-9-7-5-6-8-10(9)30-12(16(20,21)22)24-14(26)28-4-2/h5-8,11-12H,3-4H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | PBZWZHZQLUQBAL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|