C14H18Cl3N3O2S — CID 18839259
ethyl N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 18839259) has the molecular formula C14H18Cl3N3O2S and a molecular weight of 398.74 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 18839259 |
| Molecular Formula | C14H18Cl3N3O2S |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NC(NC(=S)Nc1ccccc1CC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3N3O2S/c1-3-9-7-5-6-8-10(9)18-12(23)19-11(14(15,16)17)20-13(21)22-4-2/h5-8,11H,3-4H2,1-2H3,(H,20,21)(H2,18,19,23) |
| InChIKey | KJXFYBVYAIIKPP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|