C23H26Cl3N3O3S — CID 18839539
ethyl 2-[[1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]carbamothioylamino]benzoate (PubChem CID 18839539) has the molecular formula C23H26Cl3N3O3S and a molecular weight of 530.91 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-[[1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 18839539 |
| Molecular Formula | C23H26Cl3N3O3S |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | ethyl 2-[[1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=S)NC(NC(=O)c1ccc(C(C)(C)C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H26Cl3N3O3S/c1-5-32-19(31)16-8-6-7-9-17(16)27-21(33)29-20(23(24,25)26)28-18(30)14-10-12-15(13-11-14)22(2,3)4/h6-13,20H,5H2,1-4H3,(H,28,30)(H2,27,29,33) |
| InChIKey | VKRHFHDGNRKUJA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|