C19H17Cl3N4O5S — CID 18839537
ethyl 2-[[2,2,2-trichloro-1-[(4-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 18839537) has the molecular formula C19H17Cl3N4O5S and a molecular weight of 519.79 g/mol. Its IUPAC name is ethyl 2-[[2,2,2-trichloro-1-[(4-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-[[2,2,2-trichloro-1-[(4-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 18839537 |
| Molecular Formula | C19H17Cl3N4O5S |
| Molecular Weight | 519.79 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | ethyl 2-[[2,2,2-trichloro-1-[(4-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=S)NC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H17Cl3N4O5S/c1-2-31-16(28)13-5-3-4-6-14(13)23-18(32)25-17(19(20,21)22)24-15(27)11-7-9-12(10-8-11)26(29)30/h3-10,17H,2H2,1H3,(H,24,27)(H2,23,25,32) |
| InChIKey | FVAACOWUMFAAGL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|