C26H23N3O8 — CID 3383146
ethyl 2-[[3-[(2-ethoxycarbonylphenyl)carbamoyl]-5-nitrobenzoyl]amino]benzoate (PubChem CID 3383146) has the molecular formula C26H23N3O8 and a molecular weight of 505.48 g/mol. Its IUPAC name is ethyl 2-[[3-[(2-ethoxycarbonylphenyl)carbamoyl]-5-nitrobenzoyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-[(2-ethoxycarbonylphenyl)carbamoyl]-5-nitrobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 3383146 |
| Molecular Formula | C26H23N3O8 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | ethyl 2-[[3-[(2-ethoxycarbonylphenyl)carbamoyl]-5-nitrobenzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(C(=O)Nc2ccccc2C(=O)OCC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H23N3O8/c1-3-36-25(32)19-9-5-7-11-21(19)27-23(30)16-13-17(15-18(14-16)29(34)35)24(31)28-22-12-8-6-10-20(22)26(33)37-4-2/h5-15H,3-4H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | WDGMJOFPAHNENO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|