C20H20N2O5 — CID 16959263
ethyl 3-nitro-5-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)benzoate (PubChem CID 16959263) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 3-nitro-5-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)benzoate.
| Compound Name | ethyl 3-nitro-5-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 16959263 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 3-nitro-5-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2cccc3c2CCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N2O5/c1-2-27-20(24)15-10-14(11-16(12-15)22(25)26)19(23)21-18-9-5-7-13-6-3-4-8-17(13)18/h5,7,9-12H,2-4,6,8H2,1H3,(H,21,23) |
| InChIKey | CWGALERWXSSLKP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|