C25H23N3O6S — CID 33303189
ethyl 3-[[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 33303189) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is ethyl 3-[[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 33303189 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | ethyl 3-[[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2cccc(C(=O)N3CCc4sccc4C3)c2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23N3O6S/c1-3-34-25(31)18-11-17(12-19(13-18)28(32)33)23(29)26-21-6-4-5-20(15(21)2)24(30)27-9-7-22-16(14-27)8-10-35-22/h4-6,8,10-13H,3,7,9,14H2,1-2H3,(H,26,29) |
| InChIKey | ITGZROKFTJAPEV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|