C24H25N3O5S2 — CID 33304671
N-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 33304671) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 33304671 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | N-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2cccc(C(=O)N3CCc4sccc4C3)c2C)c1 |
| InChI | InChI=1S/C24H25N3O5S2/c1-16-20(24(29)27-12-10-22-18(15-27)11-13-33-22)8-5-9-21(16)25-23(28)17-6-4-7-19(14-17)34(30,31)26(2)32-3/h4-9,11,13-14H,10,12,15H2,1-3H3,(H,25,28) |
| InChIKey | GNDZYMMMVGVFEN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|