C20H20Cl3N3O3S — CID 18839518
ethyl 2-[[2,2,2-trichloro-1-[(3-methylbenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 18839518) has the molecular formula C20H20Cl3N3O3S and a molecular weight of 488.82 g/mol. Its IUPAC name is ethyl 2-[[2,2,2-trichloro-1-[(3-methylbenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-[[2,2,2-trichloro-1-[(3-methylbenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 18839518 |
| Molecular Formula | C20H20Cl3N3O3S |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | ethyl 2-[[2,2,2-trichloro-1-[(3-methylbenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=S)NC(NC(=O)c1cccc(C)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H20Cl3N3O3S/c1-3-29-17(28)14-9-4-5-10-15(14)24-19(30)26-18(20(21,22)23)25-16(27)13-8-6-7-12(2)11-13/h4-11,18H,3H2,1-2H3,(H,25,27)(H2,24,26,30) |
| InChIKey | GZCNKCHBXGGAGG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|