C17H17Cl3N4O3S2 — CID 2252592
3-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2252592) has the molecular formula C17H17Cl3N4O3S2 and a molecular weight of 495.84 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2252592 |
| Molecular Formula | C17H17Cl3N4O3S2 |
| Molecular Weight | 495.84 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](NC(=S)Nc2ccc(S(N)(=O)=O)cc2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C17H17Cl3N4O3S2/c1-10-3-2-4-11(9-10)14(25)23-15(17(18,19)20)24-16(28)22-12-5-7-13(8-6-12)29(21,26)27/h2-9,15H,1H3,(H,23,25)(H2,21,26,27)(H2,22,24,28)/t15-/m0/s1 |
| InChIKey | IJWQUZDYUAKZRM-HNNXBMFYSA-N |
| XLogP | 3.06 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|