C18H18Cl3N3O2S — CID 2831444
3-methoxy-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2831444) has the molecular formula C18H18Cl3N3O2S and a molecular weight of 446.79 g/mol. Its IUPAC name is 3-methoxy-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2831444 |
| Molecular Formula | C18H18Cl3N3O2S |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3-methoxy-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NC(NC(=S)Nc2ccc(C)cc2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C18H18Cl3N3O2S/c1-11-6-8-13(9-7-11)22-17(27)24-16(18(19,20)21)23-15(25)12-4-3-5-14(10-12)26-2/h3-10,16H,1-2H3,(H,23,25)(H2,22,24,27) |
| InChIKey | KWTBOCIPBHQPTH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|