C19H20Cl3N3O3S — CID 30075808
3-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 30075808) has the molecular formula C19H20Cl3N3O3S and a molecular weight of 476.81 g/mol. Its IUPAC name is 3-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 30075808 |
| Molecular Formula | C19H20Cl3N3O3S |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 3-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | CCOc1ccc(NC(=S)N[C@@H](NC(=O)c2cccc(OC)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H20Cl3N3O3S/c1-3-28-14-9-7-13(8-10-14)23-18(29)25-17(19(20,21)22)24-16(26)12-5-4-6-15(11-12)27-2/h4-11,17H,3H2,1-2H3,(H,24,26)(H2,23,25,29)/t17-/m1/s1 |
| InChIKey | KOIUFRUPVTZANS-QGZVFWFLSA-N |
| XLogP | 4.51 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|