C22H25Cl4N3O2S — CID 5253781
3-chloro-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 5253781) has the molecular formula C22H25Cl4N3O2S and a molecular weight of 537.34 g/mol. Its IUPAC name is 3-chloro-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5253781 |
| Molecular Formula | C22H25Cl4N3O2S |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 3-chloro-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | CCCCCCOc1ccc(NC(=S)NC(NC(=O)c2cccc(Cl)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H25Cl4N3O2S/c1-2-3-4-5-13-31-18-11-9-17(10-12-18)27-21(32)29-20(22(24,25)26)28-19(30)15-7-6-8-16(23)14-15/h6-12,14,20H,2-5,13H2,1H3,(H,28,30)(H2,27,29,32) |
| InChIKey | UKGSSAZZPBQSED-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|