C21H21Cl4N3O3S — CID 3934820
butyl 4-[[2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 3934820) has the molecular formula C21H21Cl4N3O3S and a molecular weight of 537.30 g/mol. Its IUPAC name is butyl 4-[[2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | butyl 4-[[2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 3934820 |
| Molecular Formula | C21H21Cl4N3O3S |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | butyl 4-[[2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NC(NC(=O)c2cccc(Cl)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H21Cl4N3O3S/c1-2-3-11-31-18(30)13-7-9-16(10-8-13)26-20(32)28-19(21(23,24)25)27-17(29)14-5-4-6-15(22)12-14/h4-10,12,19H,2-3,11H2,1H3,(H,27,29)(H2,26,28,32) |
| InChIKey | AAUWHRQQXXCXNZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|