C17H13Cl4N3O3S — CID 1106829
4-[[(1S)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid (PubChem CID 1106829) has the molecular formula C17H13Cl4N3O3S and a molecular weight of 481.19 g/mol. Its IUPAC name is 4-[[(1S)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 4-[[(1S)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 1106829 |
| Molecular Formula | C17H13Cl4N3O3S |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | 4-[[(1S)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)N[C@H](NC(=O)c2cccc(Cl)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H13Cl4N3O3S/c18-11-3-1-2-10(8-11)13(25)23-15(17(19,20)21)24-16(28)22-12-6-4-9(5-7-12)14(26)27/h1-8,15H,(H,23,25)(H,26,27)(H2,22,24,28)/t15-/m0/s1 |
| InChIKey | YDELQAYVLLBVFC-HNNXBMFYSA-N |
| XLogP | 4.45 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|