C15H11Cl5N4OS — CID 3480025
3-chloro-N-[2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]benzamide (PubChem CID 3480025) has the molecular formula C15H11Cl5N4OS and a molecular weight of 472.61 g/mol. Its IUPAC name is 3-chloro-N-[2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 3480025 |
| Molecular Formula | C15H11Cl5N4OS |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | 3-chloro-N-[2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)Nc1ccc(Cl)cn1)C(Cl)(Cl)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl5N4OS/c16-9-3-1-2-8(6-9)12(25)23-13(15(18,19)20)24-14(26)22-11-5-4-10(17)7-21-11/h1-7,13H,(H,23,25)(H2,21,22,24,26) |
| InChIKey | QWXFZLGZAMVASW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|