C18H16Cl4N4O2S — CID 5254034
N-[1-[(3-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3-chlorobenzamide (PubChem CID 5254034) has the molecular formula C18H16Cl4N4O2S and a molecular weight of 494.23 g/mol. Its IUPAC name is N-[1-[(3-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3-chlorobenzamide.
| Compound Name | N-[1-[(3-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 5254034 |
| Molecular Formula | C18H16Cl4N4O2S |
| Molecular Weight | 494.23 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | N-[1-[(3-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3-chlorobenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=S)NC(NC(=O)c2cccc(Cl)c2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C18H16Cl4N4O2S/c1-10(27)23-13-6-3-7-14(9-13)24-17(29)26-16(18(20,21)22)25-15(28)11-4-2-5-12(19)8-11/h2-9,16H,1H3,(H,23,27)(H,25,28)(H2,24,26,29) |
| InChIKey | SCFSDBJBEIGPRJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|