C16H13BrCl3N3OS — CID 1101114
N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]benzamide (PubChem CID 1101114) has the molecular formula C16H13BrCl3N3OS and a molecular weight of 481.63 g/mol. Its IUPAC name is N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]benzamide.
| Compound Name | N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]benzamide |
|---|---|
| PubChem CID | 1101114 |
| Molecular Formula | C16H13BrCl3N3OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 478.90 |
| IUPAC Name | N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1cccc(Br)c1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13BrCl3N3OS/c17-11-7-4-8-12(9-11)21-15(25)23-14(16(18,19)20)22-13(24)10-5-2-1-3-6-10/h1-9,14H,(H,22,24)(H2,21,23,25)/t14-/m0/s1 |
| InChIKey | WBHLXGHICMWROK-AWEZNQCLSA-N |
| XLogP | 4.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|