C18H16Cl3N3O4S — CID 44721806
3-[[2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoic acid (PubChem CID 44721806) has the molecular formula C18H16Cl3N3O4S and a molecular weight of 476.77 g/mol. Its IUPAC name is 3-[[2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 3-[[2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 44721806 |
| Molecular Formula | C18H16Cl3N3O4S |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 3-[[2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
| SMILES | COc1ccccc1C(=O)NC(NC(=S)Nc1cccc(C(=O)O)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H16Cl3N3O4S/c1-28-13-8-3-2-7-12(13)14(25)23-16(18(19,20)21)24-17(29)22-11-6-4-5-10(9-11)15(26)27/h2-9,16H,1H3,(H,23,25)(H,26,27)(H2,22,24,29) |
| InChIKey | ZKOMVFYISVXCGW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|