C11H10Cl3N3O3S — CID 134099289
3-[(2,2,2-trichloro-1-formamidoethyl)carbamothioylamino]benzoic acid (PubChem CID 134099289) has the molecular formula C11H10Cl3N3O3S and a molecular weight of 370.65 g/mol. Its IUPAC name is 3-[(2,2,2-trichloro-1-formamidoethyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-[(2,2,2-trichloro-1-formamidoethyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 134099289 |
| Molecular Formula | C11H10Cl3N3O3S |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 3-[(2,2,2-trichloro-1-formamidoethyl)carbamothioylamino]benzoic acid |
| SMILES | O=CNC(NC(=S)Nc1cccc(C(=O)O)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3N3O3S/c12-11(13,14)9(15-5-18)17-10(21)16-7-3-1-2-6(4-7)8(19)20/h1-5,9H,(H,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | PVOXKZSQZUTDDI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|