C19H15Cl3N3O3S- — CID 2252557
3-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamothioylamino]benzoate (PubChem CID 2252557) has the molecular formula C19H15Cl3N3O3S- and a molecular weight of 471.77 g/mol. Its IUPAC name is 3-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | 3-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2252557 |
| Molecular Formula | C19H15Cl3N3O3S- |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 3-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamothioylamino]benzoate |
| SMILES | O=C(/C=C/c1ccccc1)NC(NC(=S)Nc1cccc(C(=O)[O-])c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H16Cl3N3O3S/c20-19(21,22)17(24-15(26)10-9-12-5-2-1-3-6-12)25-18(29)23-14-8-4-7-13(11-14)16(27)28/h1-11,17H,(H,24,26)(H,27,28)(H2,23,25,29)/p-1/b10-9+ |
| InChIKey | LSXABRJKGGWCEY-MDZDMXLPSA-M |
| XLogP | 2.86 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|