C19H18Cl3N3O2S — CID 2252534
(E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide (PubChem CID 2252534) has the molecular formula C19H18Cl3N3O2S and a molecular weight of 458.80 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2252534 |
| Molecular Formula | C19H18Cl3N3O2S |
| Molecular Weight | 458.80 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=S)N[C@@H](NC(=O)/C=C/c2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H18Cl3N3O2S/c1-27-15-10-8-14(9-11-15)23-18(28)25-17(19(20,21)22)24-16(26)12-7-13-5-3-2-4-6-13/h2-12,17H,1H3,(H,24,26)(H2,23,25,28)/b12-7+/t17-/m1/s1 |
| InChIKey | TXELNSOHDLUYGH-SNQZOLJRSA-N |
| XLogP | 4.51 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|