C18H15Cl4N3OS — CID 2829965
3-phenyl-N-[2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide (PubChem CID 2829965) has the molecular formula C18H15Cl4N3OS and a molecular weight of 463.22 g/mol. Its IUPAC name is 3-phenyl-N-[2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2829965 |
| Molecular Formula | C18H15Cl4N3OS |
| Molecular Weight | 463.22 g/mol |
| Exact Mass | 460.97 |
| IUPAC Name | 3-phenyl-N-[2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(NC(=S)Nc1cccc(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H15Cl4N3OS/c19-13-7-4-8-14(11-13)23-17(27)25-16(18(20,21)22)24-15(26)10-9-12-5-2-1-3-6-12/h1-11,16H,(H,24,26)(H2,23,25,27) |
| InChIKey | RNCHQAWWYPISEO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.22 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|