C11H11Cl4N3O2S — CID 2308955
methyl N-[(1S)-2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 2308955) has the molecular formula C11H11Cl4N3O2S and a molecular weight of 391.11 g/mol. Its IUPAC name is methyl N-[(1S)-2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | methyl N-[(1S)-2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 2308955 |
| Molecular Formula | C11H11Cl4N3O2S |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | methyl N-[(1S)-2,2,2-trichloro-1-[(3-chlorophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](NC(=S)Nc1cccc(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl4N3O2S/c1-20-10(19)18-8(11(13,14)15)17-9(21)16-7-4-2-3-6(12)5-7/h2-5,8H,1H3,(H,18,19)(H2,16,17,21)/t8-/m1/s1 |
| InChIKey | PCRWEDMIAVSDCL-MRVPVSSYSA-N |
| XLogP | 3.68 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|