C15H17Cl3N3O3S- — CID 2145657
3-[[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]carbamothioylamino]benzoate (PubChem CID 2145657) has the molecular formula C15H17Cl3N3O3S- and a molecular weight of 425.75 g/mol. Its IUPAC name is 3-[[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]carbamothioylamino]benzoate.
| Compound Name | 3-[[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2145657 |
| Molecular Formula | C15H17Cl3N3O3S- |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 3-[[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]carbamothioylamino]benzoate |
| SMILES | CC(C)(C)C(=O)NC(NC(=S)Nc1cccc(C(=O)[O-])c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3N3O3S/c1-14(2,3)12(24)20-11(15(16,17)18)21-13(25)19-9-6-4-5-8(7-9)10(22)23/h4-7,11H,1-3H3,(H,20,24)(H,22,23)(H2,19,21,25)/p-1 |
| InChIKey | JXMOBCKZNZYILG-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|