C20H22Cl3N3OS — CID 3961635
2,2-dimethyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]propanamide (PubChem CID 3961635) has the molecular formula C20H22Cl3N3OS and a molecular weight of 458.84 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 3961635 |
| Molecular Formula | C20H22Cl3N3OS |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(NC(=S)Nc1ccc(-c2ccccc2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H22Cl3N3OS/c1-19(2,3)17(27)25-16(20(21,22)23)26-18(28)24-15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-12,16H,1-3H3,(H,25,27)(H2,24,26,28) |
| InChIKey | QLUORJDATYUYNA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|