C11H11Cl3FN3OS — CID 5013069
2-fluoro-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]acetamide (PubChem CID 5013069) has the molecular formula C11H11Cl3FN3OS and a molecular weight of 358.65 g/mol. Its IUPAC name is 2-fluoro-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]acetamide.
| Compound Name | 2-fluoro-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 5013069 |
| Molecular Formula | C11H11Cl3FN3OS |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-fluoro-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]acetamide |
| SMILES | O=C(CF)NC(NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3FN3OS/c12-11(13,14)9(17-8(19)6-15)18-10(20)16-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,17,19)(H2,16,18,20) |
| InChIKey | XZGRNAHHWWPNSA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|