C11H11Cl3FN3O2S — CID 2252597
2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(2-hydroxyphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2252597) has the molecular formula C11H11Cl3FN3O2S and a molecular weight of 374.65 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(2-hydroxyphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(2-hydroxyphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2252597 |
| Molecular Formula | C11H11Cl3FN3O2S |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(2-hydroxyphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | O=C(CF)NC(NC(=S)Nc1ccccc1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3FN3O2S/c12-11(13,14)9(17-8(20)5-15)18-10(21)16-6-3-1-2-4-7(6)19/h1-4,9,19H,5H2,(H,17,20)(H2,16,18,21) |
| InChIKey | ZGGHFOKKLGJAIB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|