C12H10Cl3FN3O3S- — CID 7025531
4-[[(1S)-2,2,2-trichloro-1-[(2-fluoroacetyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 7025531) has the molecular formula C12H10Cl3FN3O3S- and a molecular weight of 401.65 g/mol. Its IUPAC name is 4-[[(1S)-2,2,2-trichloro-1-[(2-fluoroacetyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | 4-[[(1S)-2,2,2-trichloro-1-[(2-fluoroacetyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7025531 |
| Molecular Formula | C12H10Cl3FN3O3S- |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 4-[[(1S)-2,2,2-trichloro-1-[(2-fluoroacetyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | O=C(CF)N[C@@H](NC(=S)Nc1ccc(C(=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3FN3O3S/c13-12(14,15)10(18-8(20)5-16)19-11(23)17-7-3-1-6(2-4-7)9(21)22/h1-4,10H,5H2,(H,18,20)(H,21,22)(H2,17,19,23)/p-1/t10-/m0/s1 |
| InChIKey | QNKQVUJYOUZGGE-JTQLQIEISA-M |
| XLogP | 1.12 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|