C11H12Cl3FN4O3S2 — CID 7037232
2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 7037232) has the molecular formula C11H12Cl3FN4O3S2 and a molecular weight of 437.73 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 7037232 |
| Molecular Formula | C11H12Cl3FN4O3S2 |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)N[C@@H](NC(=O)CF)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H12Cl3FN4O3S2/c12-11(13,14)9(18-8(20)5-15)19-10(23)17-6-1-3-7(4-2-6)24(16,21)22/h1-4,9H,5H2,(H,18,20)(H2,16,21,22)(H2,17,19,23)/t9-/m1/s1 |
| InChIKey | HKLSQMLFZXEIKL-SECBINFHSA-N |
| XLogP | 1.40 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|