C18H19Cl3N4O3S2 — CID 10436344
3-phenyl-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide (PubChem CID 10436344) has the molecular formula C18H19Cl3N4O3S2 and a molecular weight of 509.87 g/mol. Its IUPAC name is 3-phenyl-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide.
| Compound Name | 3-phenyl-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 10436344 |
| Molecular Formula | C18H19Cl3N4O3S2 |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | 3-phenyl-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(NC(=O)CCc2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H19Cl3N4O3S2/c19-18(20,21)16(24-15(26)11-6-12-4-2-1-3-5-12)25-17(29)23-13-7-9-14(10-8-13)30(22,27)28/h1-5,7-10,16H,6,11H2,(H,24,26)(H2,22,27,28)(H2,23,25,29) |
| InChIKey | CRBAXVDHUDFVFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|