C36H30Cl3N3OS — CID 99662544
2-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-tritylphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 99662544) has the molecular formula C36H30Cl3N3OS and a molecular weight of 659.08 g/mol. Its IUPAC name is 2-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-tritylphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-tritylphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 99662544 |
| Molecular Formula | C36H30Cl3N3OS |
| Molecular Weight | 659.08 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 2-phenyl-N-[(1R)-2,2,2-trichloro-1-[(4-tritylphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | O=C(Cc1ccccc1)N[C@H](NC(=S)Nc1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H30Cl3N3OS/c37-36(38,39)33(41-32(43)25-26-13-5-1-6-14-26)42-34(44)40-31-23-21-30(22-24-31)35(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-24,33H,25H2,(H,41,43)(H2,40,42,44)/t33-/m1/s1 |
| InChIKey | CNZZKFCQWUCHCT-MGBGTMOVSA-N |
| XLogP | 8.41 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.08 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|