C21H18Cl3N3OS — CID 6610938
2-phenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide (PubChem CID 6610938) has the molecular formula C21H18Cl3N3OS and a molecular weight of 466.82 g/mol. Its IUPAC name is 2-phenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide.
| Compound Name | 2-phenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 6610938 |
| Molecular Formula | C21H18Cl3N3OS |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-phenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide |
| SMILES | O=C(Cc1ccccc1)NC(NC(=S)Nc1cccc2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H18Cl3N3OS/c22-21(23,24)19(26-18(28)13-14-7-2-1-3-8-14)27-20(29)25-17-12-6-10-15-9-4-5-11-16(15)17/h1-12,19H,13H2,(H,26,28)(H2,25,27,29) |
| InChIKey | PRHPVIHHJGMQMD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|