C20H17Cl3N4OS — CID 2302561
1-phenyl-3-[(1R)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]urea (PubChem CID 2302561) has the molecular formula C20H17Cl3N4OS and a molecular weight of 467.81 g/mol. Its IUPAC name is 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]urea.
| Compound Name | 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]urea |
|---|---|
| PubChem CID | 2302561 |
| Molecular Formula | C20H17Cl3N4OS |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 1-phenyl-3-[(1R)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]urea |
| SMILES | O=C(Nc1ccccc1)N[C@H](NC(=S)Nc1cccc2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H17Cl3N4OS/c21-20(22,23)17(26-18(28)24-14-9-2-1-3-10-14)27-19(29)25-16-12-6-8-13-7-4-5-11-15(13)16/h1-12,17H,(H2,24,26,28)(H2,25,27,29)/t17-/m1/s1 |
| InChIKey | XZJSBHKQYNFSJS-QGZVFWFLSA-N |
| XLogP | 5.64 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|